| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Cayman Chemical Company | USA | |||
|---|---|---|---|---|
![]() |
+1 (734) 971-3335 | |||
![]() |
sales@caymanchem.com | |||
| Chemical manufacturer | ||||
| LGC Standards | UK | |||
|---|---|---|---|---|
![]() |
+44 (20) 8943-8480 | |||
![]() |
uksales@lgcstandards.com | |||
| Chemical manufacturer since 2007 | ||||
| Organix Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (781) 932-4142 | |||
![]() |
sard@organixinc.com | |||
| Chemical manufacturer since 1986 | ||||
| Sigma-Aldrich, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Tocris Bioscience Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (636) 207-7651 | |||
![]() |
marketing@tocrisusa.com | |||
| Chemical manufacturer since 1982 | ||||
| Classification | Analytical chemistry >> Standard >> Forensic and veterinary standards |
|---|---|
| Name | Cannabinol |
| Synonyms | 6,6,9-Trimethyl-3-Pentyl-Benzo[C]Chromen-1-Ol; 6,6,9-Trimethyl-3-Pentyl-1-Benzo[C]Chromenol; 3-Amyl-6,6,9-Trimethyl-Benzo[C]Chromen-1-Ol |
| Molecular Structure | ![]() |
| Molecular Formula | C21H26O2 |
| Molecular Weight | 310.44 |
| CAS Registry Number | 521-35-7 |
| SMILES | C1=C(C)C=CC2=C1C3=C(OC2(C)C)C=C(CCCCC)C=C3O |
| InChI | 1S/C21H26O2/c1-5-6-7-8-15-12-18(22)20-16-11-14(2)9-10-17(16)21(3,4)23-19(20)13-15/h9-13,22H,5-8H2,1-4H3 |
| InChIKey | VBGLYOIFKLUMQG-UHFFFAOYSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Melting point | 76-77°C (Expl.) |
| Boiling point | 185°C (Expl.) |
| 476.5±34.0°C at 760 mmHg (Cal.) | |
| Flash point | 212.7±19.9°C (Cal.) |
| solubility | Soluble to 50 mM in DMSO and to 10 mM in ethanol |
| Safety Description | Minimize contact. |
|---|---|
| SDS | Available |
| Market Analysis Reports |