| Abacipharm Corporation | USA | |||
|---|---|---|---|---|
![]() |
+1 (410) 417-5545 | |||
![]() |
sales@abacipharm.com | |||
| Chemical manufacturer | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| ChemPacific Corp | USA | |||
|---|---|---|---|---|
![]() |
+1 (410) 633-5771 | |||
![]() |
sales@chempacific.com | |||
| Chemical manufacturer since 1995 | ||||
| Excenen Pharmatech Co., Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 (20) 8565-3352 | |||
![]() |
contact@excenen.com | |||
| Chemical manufacturer | ||||
| ZereneX Molecular Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1204) 527-700 | |||
![]() |
sales@zerenex-molecular.com | |||
| Chemical manufacturer | ||||
| Name | Isoquinoline-1,3,4-Trione |
|---|---|
| Synonyms | 1,3,4(2H)-Isoquinolinetrione; 1,3,4-(2H)Isoquinolinetrione; 5-21-11-00575 (Beilstein Handbook Reference) |
| Molecular Structure | ![]() |
| Molecular Formula | C9H5NO3 |
| Molecular Weight | 175.14 |
| CAS Registry Number | 521-73-3 |
| SMILES | C1=CC2=C(C=C1)C(NC(C2=O)=O)=O |
| InChI | 1S/C9H5NO3/c11-7-5-3-1-2-4-6(5)8(12)10-9(7)13/h1-4H,(H,10,12,13) |
| InChIKey | YIOFGHHAURBGSJ-UHFFFAOYSA-N |
| Density | 1.438g/cm3 (Cal.) |
|---|---|
| SDS | Available |
|---|---|
| (1) | Chengmei Huang, Haitao Yu, Zhengrui Miao, Jie Zhou, Shuai Wang, Hoong-Kun Fun, Jianhua Xu and Yan Zhang. Facile synthesis of spiroisoquinolines based on photocycloaddition of isoquinoline-1,3,4-trione with oxazoles, Org. Biomol. Chem., 2011, 9, 3629. |
|---|---|
| Market Analysis Reports |