| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | L-Gulonic Acid |
|---|---|
| Synonyms | D-Gluconate; D-Gluconic Acid; D-Mannonate |
| Molecular Structure | ![]() |
| Molecular Formula | C6H12O7 |
| Molecular Weight | 196.16 |
| CAS Registry Number | 526-97-6 |
| SMILES | C(O)C(O)C(O)C(O)C(O)C(O)=O |
| InChI | 1S/C6H12O7/c7-1-2(8)3(9)4(10)5(11)6(12)13/h2-5,7-11H,1H2,(H,12,13) |
| InChIKey | RGHNJXZEOKUKBD-UHFFFAOYSA-N |
| Density | 1.8±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 673.6±55.0°C at 760 mmHg (Cal.) |
| Flash point | 375.2±28.0°C (Cal.) |
| (1) | Kovacs Klara. pH oscillations and bistability in the methylene glycol-sulfite-gluconolactone reaction, Physical Chemistry Chemical Physics, 2007 |
|---|---|
| Market Analysis Reports |