| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Asinex Ltd. | Russian Federation | |||
|---|---|---|---|---|
![]() |
+7 (495) 780-3415 / 780-3417 | |||
![]() |
lsadovenko@asinex.com, | |||
| Chemical manufacturer | ||||
| Ryan Scientific, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (843)-884-4911 | |||
![]() |
sales@ryansci.com | |||
| Chemical manufacturer | ||||
| SL Drugs and Pharmaceuticals Pvt. Ltd. | India | |||
|---|---|---|---|---|
![]() |
+91 (40) 6661-1133 | |||
![]() |
enquiry@sldrugs.com | |||
| Chemical distributor since 1999 | ||||
| Name | 2-(3-Iodopropyl)-1H-Isoindole-1,3(2H)-Dione |
|---|---|
| Synonyms | 2-(3-Iodopropyl)Isoindoline-1,3-Dione; 2-(3-Iodopropyl)Isoindoline-1,3-Quinone; Nsc24938 |
| Molecular Structure | ![]() |
| Molecular Formula | C11H10INO2 |
| Molecular Weight | 315.11 |
| CAS Registry Number | 5457-29-4 |
| SMILES | C1=CC=CC2=C1C(N(C2=O)CCCI)=O |
| InChI | 1S/C11H10INO2/c12-6-3-7-13-10(14)8-4-1-2-5-9(8)11(13)15/h1-2,4-5H,3,6-7H2 |
| InChIKey | LKSISOJOXOBDGH-UHFFFAOYSA-N |
| Density | 1.796g/cm3 (Cal.) |
|---|---|
| Boiling point | 373.276°C at 760 mmHg (Cal.) |
| Flash point | 179.551°C (Cal.) |
| (1) | K. Chandramohan, K. Ravikumar and S. Rajendar. N-(3-Iodopropyl)phthalimide, Acta Cryst. (2000). C56, e298-e299 |
|---|---|
| Market Analysis Reports |