| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Fluorochem Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1457) 860-111 | |||
![]() |
enquiries@fluorochem.co.uk | |||
| Chemical manufacturer | ||||
| Name | Ethyl (2E)-4-Phenyl-2-Butenoate |
|---|---|
| Synonyms | 2-BUTENOIC ACID,4-PHENYL-,ETHYL ESTER; Ethyl (2E)-4-phenyl-2-butenoate #; Ethyl 4-phenylbut-2-enoate |
| Molecular Structure | ![]() |
| Molecular Formula | C12H14O2 |
| Molecular Weight | 190.24 |
| CAS Registry Number | 559062-83-8 |
| SMILES | CCOC(=O)/C=C/CC1=CC=CC=C1 |
| InChI | 1S/C12H14O2/c1-2-14-12(13)10-6-9-11-7-4-3-5-8-11/h3-8,10H,2,9H2,1H3/b10-6+ |
| InChIKey | LYZBCBTUPJJIKA-UXBLZVDNSA-N |
| Density | 1.0±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 281.4±19.0°C at 760 mmHg (Cal.) |
| Flash point | 150.9±12.6°C (Cal.) |
| Refractive index | 1.518 (Cal.) |
| Safety Description | IRRITANT |
|---|---|
| SDS | Available |
| (1) | Paul G. Bulger, Mark G. Moloney and Paul C. Trippier. A multicomponent coupling strategy suitable for the synthesis of the triene component of the oxazolomycin antibiotics, Org. Biomol. Chem., 2003, 1, 3726. |
|---|---|
| Market Analysis Reports |