| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Merck Millipore | USA | |||
|---|---|---|---|---|
![]() |
+86 (10) 5989-8600 | |||
![]() |
asiatechserv@millipore.com | |||
| Chemical manufacturer since 1954 | ||||
| Ryan Scientific, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (843)-884-4911 | |||
![]() |
sales@ryansci.com | |||
| Chemical manufacturer | ||||
| SYNTHON Chemicals GmbH & Co. KG | Germany | |||
|---|---|---|---|---|
![]() |
+49 (34) 9463-6900 | |||
![]() |
synthon@synthon-chemicals.com | |||
| Chemical manufacturer | ||||
| Name | 1,13-Bis(8-Quinolyl)-1,4,7,10,13-Pentaoxatridecane |
|---|---|
| Synonyms | 8-[2-[2-[2-[2-(8-Quinolyloxy)Ethoxy]Ethoxy]Ethoxy]Ethoxy]Quinoline; Quinoline, 8,8'-(Oxybis(2,1-Ethanediyloxy-2,1-Ethanediyloxy))Bis-; Kryptofix 5 |
| Molecular Structure | ![]() |
| Molecular Formula | C26H28N2O5 |
| Molecular Weight | 448.52 |
| CAS Registry Number | 57310-75-5 |
| EINECS | 260-674-9 |
| SMILES | C1=CC=C(C2=NC=CC=C12)OCCOCCOCCOCCOC3=CC=CC4=CC=CN=C34 |
| InChI | 1S/C26H28N2O5/c1-5-21-7-3-11-27-25(21)23(9-1)32-19-17-30-15-13-29-14-16-31-18-20-33-24-10-2-6-22-8-4-12-28-26(22)24/h1-12H,13-20H2 |
| InChIKey | GHYUCQLUMXYVRT-UHFFFAOYSA-N |
| Density | 1.208g/cm3 (Cal.) |
|---|---|
| Melting point | 71-74°C (Expl.) |
| Boiling point | 624.782°C at 760 mmHg (Cal.) |
| Flash point | 215.177°C (Cal.) |
| (1) | Ki-Min Park, Hyun Jee Kim, Suk-Hee Moon, Jagadese J. Vittal, Jong Hwa Jung and Shim Sung Lee. Surprisingly stable ammonium ion complex of a non-cyclic crown-type polyether: solid and solution studies, New J. Chem., 2010, 34, 603. |
|---|---|
| Market Analysis Reports |