| Trylead Chemical Technology Co., Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 (571) 8708-6220 | |||
![]() |
info@trylead-chem.com | |||
| Chemical manufacturer since 2006 | ||||
| Name | 2,4,6-Triiodophloroglucinol |
|---|---|
| Synonyms | 2,4,6-Triiodophloroglucinol |
| Molecular Structure | ![]() |
| Molecular Formula | C6H3I3O3 |
| Molecular Weight | 503.80 |
| CAS Registry Number | 57730-42-4 |
| SMILES | C1(=C(O)C(=C(O)C(=C1O)I)I)I |
| InChI | 1S/C6H3I3O3/c7-1-4(10)2(8)6(12)3(9)5(1)11/h10-12H |
| InChIKey | YUQIVUXABFZTSY-UHFFFAOYSA-N |
| Density | 3.338g/cm3 (Cal.) |
|---|---|
| Boiling point | 232.146°C at 760 mmHg (Cal.) |
| Flash point | 94.199°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Naba K. Nath, Binoy K. Saha and Ashwini Nangia. Isostructural polymorphs of triiodophloroglucinol and triiodoresorcinol, New J. Chem., 2008, 32, 1693. |
|---|---|
| Market Analysis Reports |