| Atomax Chemicals Co., Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 13417589054/ | |||
![]() |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
![]() |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | N-Acetyl-2-Isobutylleucine |
|---|---|
| Synonyms | 2-acetamido-2-isobutyl-4-methylpentanoic acid; N-Acetyl-a,a-diisobutylglycine |
| Molecular Structure | ![]() |
| Molecular Formula | C12H23NO3 |
| Molecular Weight | 229.32 |
| CAS Registry Number | 588708-33-2 |
| SMILES | CC(C)CC(CC(C)C)(C(=O)O)NC(=O)C |
| InChI | 1S/C12H23NO3/c1-8(2)6-12(11(15)16,7-9(3)4)13-10(5)14/h8-9H,6-7H2,1-5H3,(H,13,14)(H,15,16) |
| InChIKey | PSZOYVKEMGAHQP-UHFFFAOYSA-N |
| Density | 1.0±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 398.6±25.0°C at 760 mmHg (Cal.) |
| Flash point | 194.9±23.2°C (Cal.) |
| Refractive index | 1.462 (Cal.) |
| (1) | Susana P. G. Costa, Hernâni L. S. Maia and Sílvia M. M. A. Pereira-Lima. An improved approach for the synthesis of a,a-dialkyl glycine derivatives by the Ugi–Passerini reaction, Org. Biomol. Chem., 2003, 1, 1475. |
|---|---|
| Market Analysis Reports |