| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | 1,1-Dinitroethane |
|---|---|
| Synonyms | 1,1-Dinitroethane (Dry) [Forbidden]; 4-01-00-00174 (Beilstein Handbook Reference); Brn 1758537 |
| Molecular Structure | ![]() |
| Molecular Formula | C2H4N2O4 |
| Molecular Weight | 120.06 |
| CAS Registry Number | 600-40-8 |
| SMILES | CC([N+]([O-])=O)[N+]([O-])=O |
| InChI | 1S/C2H4N2O4/c1-2(3(5)6)4(7)8/h2H,1H3 |
| InChIKey | LKKHEZBRRGJBGH-UHFFFAOYSA-N |
| Density | 1.372g/cm3 (Cal.) |
|---|---|
| Boiling point | 185.499°C at 760 mmHg (Cal.) |
| Flash point | 79.013°C (Cal.) |
| (1) | R. Gilardi, C. George and J. L. Flippen-Anderson. Structure of 1,1,3,3-tetranitrocyclobutane, Acta Cryst. (1992). C48, 1680-1681 |
|---|---|
| Market Analysis Reports |