| AccuStandard Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (203) 786-5290 | |||
![]() |
orders@accustandard.com | |||
| Chemical manufacturer since 1986 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Crescent Chemical Co. Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 348-0333 | |||
![]() |
crescent@creschem.com | |||
| Chemical distributor | ||||
| SelectLab Chemicals GmbH | Germany | |||
|---|---|---|---|---|
![]() |
+49 (2383) 919-350 / 919-351 | |||
![]() |
info@selectlab.de, | |||
| Chemical manufacturer | ||||
| Classification | Organic raw materials >> Inorganic acid ester |
|---|---|
| Name | Glycol dinitrate |
| Synonyms | Nitric Acid 2-Nitrooxyethyl Ester; 1,2-Ethanediol, Dinitrate; 4-01-00-02413 (Beilstein Handbook Reference) |
| Molecular Structure | ![]() |
| Molecular Formula | C2H4N2O6 |
| Molecular Weight | 152.06 |
| CAS Registry Number | 628-96-6 |
| EINECS | 211-063-0 |
| SMILES | C(O[N+]([O-])=O)CO[N+]([O-])=O |
| InChI | 1S/C2H4N2O6/c5-3(6)9-1-2-10-4(7)8/h1-2H2 |
| InChIKey | UQXKXGWGFRWILX-UHFFFAOYSA-N |
| Density | 1.5±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 199.5±13.0°C at 760 mmHg (Cal.) |
| 197.2222°C (Expl.) | |
| Flash point | 104.3±21.8°C (Cal.) |
| 215°C (Expl.) | |
| solubility | Insoluble |
| (1) | Evandro Piccin, Nicolò Dossi, Avi Cagan, Emanuel Carrilho and Joseph Wang. Rapid and sensitive measurements of nitrate ester explosives using microchip electrophoresis with electrochemical detection, Analyst, 2009, 134, 528. |
|---|---|
| Market Analysis Reports |