| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | 3-Hydroxyfluorene |
|---|---|
| Synonyms | Fluoren-3-Ol; Nsc51318 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H10O |
| Molecular Weight | 182.22 |
| CAS Registry Number | 6344-67-8 |
| SMILES | C1=CC=CC3=C1C2=CC(=CC=C2C3)O |
| InChI | 1S/C13H10O/c14-11-6-5-10-7-9-3-1-2-4-12(9)13(10)8-11/h1-6,8,14H,7H2 |
| InChIKey | PVUBSZGNXLNTLX-UHFFFAOYSA-N |
| Density | 1.242g/cm3 (Cal.) |
|---|---|
| Boiling point | 358.896°C at 760 mmHg (Cal.) |
| Flash point | 175.103°C (Cal.) |
| (1) | Zheng Li, James A. Mulholland, Lovisa C. Romanoff, Erin N. Pittman, Debra A. Trinidad, Michael D. Lewin and Andreas Sjödin. Assessment of non-occupational exposure to polycyclic aromatic hydrocarbons through personal air sampling and urinary biomonitoring, J. Environ. Monit., 2010, 12, 1110. |
|---|---|
| Market Analysis Reports |