| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| Cayman Chemical Company | USA | |||
|---|---|---|---|---|
![]() |
+1 (734) 971-3335 | |||
![]() |
sales@caymanchem.com | |||
| Chemical manufacturer | ||||
| Santa Cruz Biotechnology, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (831) 457-3800 | |||
![]() |
scbt@scbt.com | |||
| Chemical manufacturer | ||||
| Sigma-Aldrich, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Tocris Bioscience Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (636) 207-7651 | |||
![]() |
marketing@tocrisusa.com | |||
| Chemical manufacturer since 1982 | ||||
| VDM Biochemicals | USA | |||
|---|---|---|---|---|
![]() |
+1 (330) 252-8181/ | |||
![]() |
sales@vdmbio.com,info@vdmbio.com | |||
| Chemical manufacturer | ||||
| Name | 6-Chloro-1-phenyl-2,3,4,5-tetrahydro-1H-3-benzazepine-7,8-diol hydrobromide (1:1) |
|---|---|
| Synonyms | "6-?chlor |
| Molecular Structure | ![]() |
| Molecular Formula | C16H17BrClNO2 |
| Molecular Weight | 370.67 |
| CAS Registry Number | 67287-39-2 |
| SMILES | C1CNCC(C2=CC(=C(C(=C21)Cl)O)O)C3=CC=CC=C3.Br |
| InChI | 1S/C16H16ClNO2.BrH/c17-15-11-6-7-18-9-13(10-4-2-1-3-5-10)12(11)8-14(19)16(15)20;/h1-5,8,13,18-20H,6-7,9H2;1H |
| InChIKey | RMIJGBMRNYUZRG-UHFFFAOYSA-N |
| solubility | Soluble to 100 mM in DMSO and to 10 mM in water |
|---|---|
| SDS | Available |
|---|---|
| Market Analysis Reports |