| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| ChemSampCo, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (609) 656-2440 | |||
![]() |
sales@chemsampco.com | |||
| Chemical manufacturer since 1960 | ||||
| Name | Octahydro-Pentalene |
|---|---|
| Synonyms | Inchi=1/C8h14/C1-3-7-5-2-6-8(7)4-1/H7-8H,1-6H2/T7-,8; Cis-Bicyclo[3.3.0]Octane; Trans-Bicyclo(3.3.0)Octane |
| Molecular Structure | ![]() |
| Molecular Formula | C8H14 |
| Molecular Weight | 110.20 |
| CAS Registry Number | 694-72-4 |
| SMILES | C1CCC2C1CCC2 |
| InChI | 1S/C8H14/c1-3-7-5-2-6-8(7)4-1/h7-8H,1-6H2 |
| InChIKey | AEBWATHAIVJLTA-UHFFFAOYSA-N |
| Density | 0.896g/cm3 (Cal.) |
|---|---|
| Boiling point | 140.504°C at 760 mmHg (Cal.) |
| Flash point | 19.445°C (Cal.) |
| (1) | Xue-Fang Shi, Hai-Bin Song, Lei He and Wen-Qin Zhang. Observation of a quasi-one-dimensional water aggregate in a supramolecular organic host, CrystEngComm, 2009, 11, 542. |
|---|---|
| Market Analysis Reports |