| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | 5-Dodecyldihydro-2(3H)-Furanone |
|---|---|
| Synonyms | 5-Dodecyltetrahydrofuran-2-One; 5-Dodecyl-2-Tetrahydrofuranone; 5-Lauryltetrahydrofuran-2-One |
| Molecular Structure | ![]() |
| Molecular Formula | C16H30O2 |
| Molecular Weight | 254.41 |
| CAS Registry Number | 730-46-1 |
| SMILES | C(CC1OC(CC1)=O)CCCCCCCCCC |
| InChI | 1S/C16H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-15-13-14-16(17)18-15/h15H,2-14H2,1H3 |
| InChIKey | SRIFJCOBFTWCTM-UHFFFAOYSA-N |
| Density | 0.912g/cm3 (Cal.) |
|---|---|
| Boiling point | 349.188°C at 760 mmHg (Cal.) |
| Flash point | 145.434°C (Cal.) |
| (1) | Niiha Sasakura, Keiji Nakano, Yoshiyasu Ichikawa and Hiyoshizo Kotsuki. A new environmentally friendly method for the Baeyer–Villiger oxidation of cyclobutanones catalyzed by thioureas using HO as an oxidant, RSC Advances, 2012, 2, 6135. |
|---|---|
| Market Analysis Reports |