| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| Gelest, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (215) 547-1015 | |||
![]() |
info@gelest.com | |||
| Chemical manufacturer | ||||
| Santa Cruz Biotechnology, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (831) 457-3800 | |||
![]() |
scbt@scbt.com | |||
| Chemical manufacturer | ||||
| Sigma-Aldrich, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Classification | Organic raw materials >> Amino compound >> Cycloalkylamines, aromatic monoamines, aromatic polyamines and derivatives and salts |
|---|---|
| Name | N-(3-Chlorophenyl)-1,1,1-trimethyl-N-(trimethylsilyl)silanamine |
| Synonyms | 3-Chloro-N,N-bis(trimethylsilyl)aniline; 3-CHLORO-NN-BIS ANILINE&; 371327_ALDRICH |
| Molecular Structure | ![]() |
| Molecular Formula | C12H22ClNSi2 |
| Molecular Weight | 271.93 |
| CAS Registry Number | 7522-27-2 |
| SMILES | Clc1cc(N([Si](C)(C)C)[Si](C)(C)C)ccc1 |
| InChI | 1S/C12H22ClNSi2/c1-15(2,3)14(16(4,5)6)12-9-7-8-11(13)10-12/h7-10H,1-6H3 |
| InChIKey | QFZHUSXLYYOLGX-UHFFFAOYSA-N |
| Density | 0.982g/cm3 (Cal.) |
|---|---|
| Boiling point | 284.925°C at 760 mmHg (Cal.) |
| Flash point | 126.119°C (Cal.) |
| Market Analysis Reports |