| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Exclusive Chemistry Ltd. | Russian Federation | |||
|---|---|---|---|---|
![]() |
+7 (903) 713-5556 | |||
![]() |
info@exchemistry.com | |||
| Chemical manufacturer | ||||
| Name | 2-Bromo-5-Nitrofuran |
|---|---|
| Synonyms | 2-Bromo-5-Nitro-Furan; Ec-000.1575; Nsc32225 |
| Molecular Structure | ![]() |
| Molecular Formula | C4H2BrNO3 |
| Molecular Weight | 191.97 |
| CAS Registry Number | 823-73-4 |
| SMILES | C1=C(OC(=C1)Br)[N+](=O)[O-] |
| InChI | 1S/C4H2BrNO3/c5-3-1-2-4(9-3)6(7)8/h1-2H |
| InChIKey | QGTDMAKRJHGXOF-UHFFFAOYSA-N |
| Density | 1.915g/cm3 (Cal.) |
|---|---|
| Melting point | 47°C (Expl.) |
| Boiling point | 209.719°C at 760 mmHg (Cal.) |
| Flash point | 80.636°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Farhad Karimi and Bengt Långström. Palladium-mediated synthesis of [carbonyl-C]amides and hydrazides using [C]carbon monoxide, J. Chem. Soc., Perkin Trans. 1, 2002, 0, 2111. |
|---|---|
| Market Analysis Reports |