| Sigma-Aldrich, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| chemBlink massive supplier since 2018 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Classification | Catalysts and additives >> Polymer |
|---|---|
| Name | 2-Propenoic acid polymer with diethenyl benzene |
| Synonyms | Acrylic Acid; 1,2-Divinylbenzene; 2-Propenoic Acid, Polymer With Diethenyl Benzene; 2-Propenoic Acid, Polymer With Diethenylbenzene |
| Molecular Formula | C13H14O2 |
| Molecular Weight | 202.25 |
| CAS Registry Number | 9052-45-3 |
| SMILES | O=C(O)C=C.C1=C(C(=CC=C1)C=C)C=C |
| InChI | 1S/C10H10.C3H4O2/c1-3-9-7-5-6-8-10(9)4-2;1-2-3(4)5/h3-8H,1-2H2;2H,1H2,(H,4,5) |
| InChIKey | TXDYWJDYXZCRAN-UHFFFAOYSA-N |
| Boiling point | 207.3°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 71.9°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |