|
CAS#: 92-97-7 Product: Thiocarbanidin No suppilers available for the product. |
| Name | Thiocarbanidin |
|---|---|
| Synonyms | 1-(4-Isobutoxyphenyl)-3-[4-(2-Pyridyl)Phenyl]Thiourea; N,N'-Bis(1,1'-Biphenyl-4-Yl)Thiourea; Thioban |
| Molecular Structure | ![]() |
| Molecular Formula | C22H23N3OS |
| Molecular Weight | 377.50 |
| CAS Registry Number | 92-97-7 |
| SMILES | C2=C(C1=CC=CC=N1)C=CC(=C2)NC(NC3=CC=C(OCC(C)C)C=C3)=S |
| InChI | 1S/C22H23N3OS/c1-16(2)15-26-20-12-10-19(11-13-20)25-22(27)24-18-8-6-17(7-9-18)21-5-3-4-14-23-21/h3-14,16H,15H2,1-2H3,(H2,24,25,27) |
| InChIKey | WBZHNJKKIOZEEE-UHFFFAOYSA-N |
| Density | 1.217g/cm3 (Cal.) |
|---|---|
| Boiling point | 523.363°C at 760 mmHg (Cal.) |
| Flash point | 270.321°C (Cal.) |
| (1) | Philip Prathipati, Ngai Ling Ma* and Thomas H. Keller. Global Bayesian Models for the Prioritization of Antitubercular Agents, J. Chem. Inf. Model., 2008, 48 (12), pp 2362–2370 |
|---|---|
| Market Analysis Reports |