Online Database of Chemicals from Around the World
|
CAS#: 962-32-3 Product: 1A,11B-Dihydrobenz(3,4)Anthra(1,2-B)Oxirene No suppilers available for the product. |
| Name | 1A,11B-Dihydrobenz(3,4)Anthra(1,2-B)Oxirene |
|---|---|
| Synonyms | 3,4-Dihydro-3,4-Epoxy-1,2-Benzanthracene; 5,6-Epoxy-5,6-Dihydrobenz(A)Anthracene; Benz(3,4)Anthra(1,2-B)Oxirene, 1A,11B-Dihydro- (9Ci) |
| Molecular Structure |  |
| Molecular Formula | C18H12O |
| Molecular Weight | 244.29 |
| CAS Registry Number | 962-32-3 |
| SMILES | C1=CC=CC3=C1C2OC2C4=C3C=C5C(=C4)C=CC=C5 |
| InChI | 1S/C18H12O/c1-2-6-12-10-16-15(9-11(12)5-1)13-7-3-4-8-14(13)17-18(16)19-17/h1-10,17-18H |
| InChIKey | APIRAYPNDXRJBP-UHFFFAOYSA-N |
| Density | 1.286g/cm3 (Cal.) |
|---|---|
| Boiling point | 447.252°C at 760 mmHg (Cal.) |
| Flash point | 212.364°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1A,11B-Dihydrobenz(3,4)Anthra(1,2-B)Oxirene |