Online Database of Chemicals from Around the World
|
CAS#: 10537-41-4 Product: 4-Hydroxy-5-Isopropyl-3-Methylbenzaldehyde No suppilers available for the product. |
| Name | 4-Hydroxy-5-Isopropyl-3-Methylbenzaldehyde |
|---|---|
| Synonyms | 4-Hydroxy-3-Isopropyl-5-Methyl-Benzaldehyde; 4-Hydroxy-3-Isopropyl-5-Methylbenzaldehyde; 4-Hydroxy-3-Methyl-5-Propan-2-Yl-Benzaldehyde |
| Molecular Structure |  |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 |
| CAS Registry Number | 10537-41-4 |
| EINECS | 234-109-1 |
| SMILES | C1=C(C(=C(C=C1C=O)C)O)C(C)C |
| InChI | 1S/C11H14O2/c1-7(2)10-5-9(6-12)4-8(3)11(10)13/h4-7,13H,1-3H3 |
| InChIKey | MZGYHGQVVFEMIG-UHFFFAOYSA-N |
| Density | 1.074g/cm3 (Cal.) |
|---|---|
| Boiling point | 277.312°C at 760 mmHg (Cal.) |
| Flash point | 115.988°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Hydroxy-5-Isopropyl-3-Methylbenzaldehyde |