Online Database of Chemicals from Around the World
| Name | 1,2,3,6,7,8-Hexabromodibenzofuran |
|---|---|
| Synonyms | 1,2,3,6,7,8-Hxbdf; 1,2,3,6,7,8-Hexabromo-Dibenzofuran; Dibenzofuran, 1,2,3,6,7,8-Hexabromo- |
| Molecular Structure |  |
| Molecular Formula | C12H2Br6O |
| Molecular Weight | 641.57 |
| CAS Registry Number | 107555-94-2 |
| SMILES | C1=C3C(=C(C(=C1Br)Br)Br)C2=CC(=C(C(=C2O3)Br)Br)Br |
| InChI | 1S/C12H2Br6O/c13-4-1-3-7-6(2-5(14)8(15)10(7)17)19-12(3)11(18)9(4)16/h1-2H |
| InChIKey | VUAFSJIMHSEWBL-UHFFFAOYSA-N |
| Density | 2.701g/cm3 (Cal.) |
|---|---|
| Boiling point | 577.156°C at 760 mmHg (Cal.) |
| Flash point | 302.853°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,3,6,7,8-Hexabromodibenzofuran |
