|
CAS#: 110623-33-1 Product: 5-(3-Fluorophenyl)-2,4-Dimethyl-1,2,4-Triazole-3-Thione No suppilers available for the product. |
| Name | 5-(3-Fluorophenyl)-2,4-Dimethyl-1,2,4-Triazole-3-Thione |
|---|---|
| Synonyms | Mdl-26479; 3H-1,2,4-Triazole-3-Thione, 2,4-Dihydro-2,4-Dimethyl-5-(3-Fluorophenyl)-; 3H-1,2,4-Triazole-3-Thione, 5-(3-Fluorophenyl)-2,4-Dihydro-2,4-Dimethyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C10H10FN3S |
| Molecular Weight | 223.27 |
| CAS Registry Number | 110623-33-1 |
| SMILES | C1=C(C=CC=C1C2=NN(C)C(N2C)=S)F |
| InChI | 1S/C10H10FN3S/c1-13-9(12-14(2)10(13)15)7-4-3-5-8(11)6-7/h3-6H,1-2H3 |
| InChIKey | IWDUZEHNLHFBRZ-UHFFFAOYSA-N |
| Density | 1.293g/cm3 (Cal.) |
|---|---|
| Boiling point | 279.3°C at 760 mmHg (Cal.) |
| Flash point | 122.717°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-(3-Fluorophenyl)-2,4-Dimethyl-1,2,4-Triazole-3-Thione |