|
CAS#: 113403-10-4 Product: (2S)-2-(4-Isobutylphenyl)Propanoic Acid - L-Lysine Hydrate (1:1:1) No suppilers available for the product. |
| Name | (2S)-2-(4-Isobutylphenyl)Propanoic Acid - L-Lysine Hydrate (1:1:1) |
|---|---|
| Synonyms | Dexibuprofen lysine; Doctrin; Doctrin (TN) |
| Molecular Structure | ![]() |
| Molecular Formula | C19H34N2O5 |
| Molecular Weight | 370.48 |
| CAS Registry Number | 113403-10-4 |
| SMILES | O=C(O)[C@@H](N)CCCCN.O=C(O)[C@H](c1ccc(cc1)CC(C)C)C.O |
| InChI | 1S/C13H18O2.C6H14N2O2.H2O/c1-9(2)8-11-4-6-12(7-5-11)10(3)13(14)15;7-4-2-1-3-5(8)6(9)10;/h4-7,9-10H,8H2,1-3H3,(H,14,15);5H,1-4,7-8H2,(H,9,10);1H2/t10-;5-;/m00./s1 |
| InChIKey | ZLGIZCLYTDPXEP-LQDNOSPQSA-N |
| Boiling point | 319.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 216.7°C (Cal.) |
| Refractive index | (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2S)-2-(4-Isobutylphenyl)Propanoic Acid - L-Lysine Hydrate (1:1:1) |