|
CAS#: 120154-96-3 Product: Dibenzo(b,j)Dipyrido(4,3,2-de:2',3',4'-gh)(1,10)Phenanthroline No suppilers available for the product. |
| Name | Dibenzo(b,j)Dipyrido(4,3,2-de:2',3',4'-gh)(1,10)Phenanthroline |
|---|---|
| Synonyms | Eilatin; Eilatine |
| Molecular Structure | ![]() |
| Molecular Formula | C24H12N4 |
| Molecular Weight | 356.39 |
| CAS Registry Number | 120154-96-3 |
| SMILES | C1=CN=C5C2=C1C7=C(N=C2C4=NC3=C(C=CC=C3)C6=C4C5=NC=C6)C=CC=C7 |
| InChI | 1S/C24H12N4/c1-3-7-17-13(5-1)15-9-11-25-21-19(15)23(27-17)24-20-16(10-12-26-22(20)21)14-6-2-4-8-18(14)28-24/h1-12H |
| InChIKey | XLONQTAYDCFVPP-UHFFFAOYSA-N |
| Density | 1.502g/cm3 (Cal.) |
|---|---|
| Boiling point | 675.362°C at 760 mmHg (Cal.) |
| Flash point | 311.219°C (Cal.) |
| (1) | Z. Stein and I. Goldberg. [pi]-[pi] stacking in 7,8,15,16-tetraazadibenzo[b,n]perylene monohydrate at 110Â K, Acta Cryst. (2005). E61, o1554-o1556 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Dibenzo(b,j)Dipyrido(4,3,2-de:2',3',4'-gh)(1,10)Phenanthroline |