Online Database of Chemicals from Around the World
| Name | 6-T-Butyl-1,3,8-Trichlorodibenzofuran |
|---|---|
| Synonyms | 6-Tert-Butyl-1,3,8-Trichloro-Dibenzofuran; Aids-105024; Aids105024 |
| Molecular Structure |  |
| Molecular Formula | C16H13Cl3O |
| Molecular Weight | 327.64 |
| CAS Registry Number | 125652-12-2 |
| SMILES | C3=C(C=C2OC1=C(C=C(C=C1C2=C3Cl)Cl)C(C)(C)C)Cl |
| InChI | 1S/C16H13Cl3O/c1-16(2,3)11-5-8(17)4-10-14-12(19)6-9(18)7-13(14)20-15(10)11/h4-7H,1-3H3 |
| InChIKey | NEMXOMXYPDWFFE-UHFFFAOYSA-N |
| Density | 1.348g/cm3 (Cal.) |
|---|---|
| Boiling point | 409.647°C at 760 mmHg (Cal.) |
| Flash point | 201.548°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-T-Butyl-1,3,8-Trichlorodibenzofuran |
