|
CAS#: 13017-11-3 Product: Elephantopin No suppilers available for the product. |
| Name | Elephantopin |
|---|---|
| Synonyms | C09403; Elephantopin; Lmpr01030022 |
| Molecular Structure | ![]() |
| Molecular Formula | C19H20O7 |
| Molecular Weight | 360.36 |
| CAS Registry Number | 13017-11-3 |
| SMILES | [C@@]34([C@@H]([C@@H]1[C@H](C(=C)C(O1)=O)[C@@H](OC(C(=C)C)=O)CC2=C[C@H](OC2=O)C3)O4)C |
| InChI | 1S/C19H20O7/c1-8(2)16(20)24-12-6-10-5-11(23-18(10)22)7-19(4)15(26-19)14-13(12)9(3)17(21)25-14/h5,11-15H,1,3,6-7H2,2,4H3/t11-,12-,13+,14-,15+,19+/m0/s1 |
| InChIKey | WIQOUTANBFOBPB-KIVXNUBRSA-N |
| Density | 1.344g/cm3 (Cal.) |
|---|---|
| Boiling point | 593.695°C at 760 mmHg (Cal.) |
| Flash point | 262.282°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Elephantopin |