Online Database of Chemicals from Around the World
|
CAS#: 13181-63-0 Product: N,N-Dimethyl-N'-(3,4-Xylyl)Formamidine No suppilers available for the product. |
| Name | N,N-Dimethyl-N'-(3,4-Xylyl)Formamidine |
|---|---|
| Synonyms | N'-(3,4-Dimethylphenyl)-N,N-Dimethyl-Formamidine; N'-(3,4-Dimethylphenyl)-N,N-Dimethylformamidine; N'-(3,4-Dimethylphenyl)-N,N-Dimethyl-Methanimidamide |
| Molecular Structure |  |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 |
| CAS Registry Number | 13181-63-0 |
| SMILES | C1=C(C(=CC=C1N=CN(C)C)C)C |
| InChI | 1S/C11H16N2/c1-9-5-6-11(7-10(9)2)12-8-13(3)4/h5-8H,1-4H3 |
| InChIKey | XWNIJAMAQNWJCQ-UHFFFAOYSA-N |
| Density | 0.913g/cm3 (Cal.) |
|---|---|
| Boiling point | 284.719°C at 760 mmHg (Cal.) |
| Flash point | 125.994°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N,N-Dimethyl-N'-(3,4-Xylyl)Formamidine |