Online Database of Chemicals from Around the World
|
CAS#: 13345-64-7 Product: 7,8,12-Trimethylbenz(a)Anthracene No suppilers available for the product. |
| Name | 7,8,12-Trimethylbenz(a)Anthracene |
|---|---|
| Synonyms | 7,8,12-Tmba; 7,8,12-Trimethylbenz(A)Anthracene; Brn 2374656 |
| Molecular Structure |  |
| Molecular Formula | C21H18 |
| Molecular Weight | 270.37 |
| CAS Registry Number | 13345-64-7 |
| SMILES | C2=CC=C1C(=C3C(=C(C)C1=C2C)C=CC4=CC=CC=C34)C |
| InChI | 1S/C21H18/c1-13-7-6-10-17-15(3)21-18(14(2)20(13)17)12-11-16-8-4-5-9-19(16)21/h4-12H,1-3H3 |
| InChIKey | NQIIOABBGPROQW-UHFFFAOYSA-N |
| Density | 1.124g/cm3 (Cal.) |
|---|---|
| Boiling point | 482.923°C at 760 mmHg (Cal.) |
| Flash point | 239.991°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7,8,12-Trimethylbenz(a)Anthracene |