Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | N-[[(Dimethylamino)Carbonyl]Oxy]-Butanimidoyl Chloride |
|---|---|
| Synonyms | N,N-Dimethylcarbamic Acid (1-Chlorobutylideneamino) Ester; Brn 4859995; Butanimidoyl Chloride, N-(((Dimethylamino)Carbonyl)Oxy)- |
| Molecular Structure | ![CAS#: 134871-01-5， N-[[(Dimethylamino)Carbonyl]Oxy]-Butanimidoyl Chloride](/moreStructures/134871-01-5.gif) |
| Molecular Formula | C7H13ClN2O2 |
| Molecular Weight | 192.64 |
| CAS Registry Number | 134871-01-5 |
| SMILES | C(/C(Cl)=N/OC(=O)N(C)C)CC |
| InChI | 1S/C7H13ClN2O2/c1-4-5-6(8)9-12-7(11)10(2)3/h4-5H2,1-3H3/b9-6- |
| InChIKey | NEZRGEOILOKAAG-TWGQIWQCSA-N |
| Density | 1.125g/cm3 (Cal.) |
|---|---|
| Boiling point | 227.414°C at 760 mmHg (Cal.) |
| Flash point | 91.337°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-[[(Dimethylamino)Carbonyl]Oxy]-Butanimidoyl Chloride |