Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | D-Glucose-5-C-T |
|---|---|
| Synonyms | (2R,3S,4S,5R)-2,3,4,5,6-Pentahydroxy-5-Tritio-Hexanal; D-(5-3H) Glucose; D-(5-3H)Glucose |
| Molecular Structure |  |
| Molecular Formula | C6H11TO6 |
| Molecular Weight | 182.17 |
| CAS Registry Number | 14049-06-0 |
| SMILES | [C@@](CO)([C@H]([C@@H]([C@H](C=O)O)O)O)(O)[3H] |
| InChI | 1S/C6H12O6/c7-1-3(9)5(11)6(12)4(10)2-8/h1,3-6,8-12H,2H2/t3-,4+,5+,6+/m0/s1/i4T |
| InChIKey | GZCGUPFRVQAUEE-CPMQAFPASA-N |
| Density | 1.599g/cm3 (Cal.) |
|---|---|
| Boiling point | 527.112°C at 760 mmHg (Cal.) |
| Flash point | 286.664°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for D-Glucose-5-C-T |