| Amadis Chemical Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (571) 8992-5085 | |||
![]() |
sales@amadischem.com | |||
![]() |
Skype Chat | |||
| Chemical manufacturer since 2011 | ||||
| Manchester Organics Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (1928) 710-200 | |||
![]() |
info@manchesterorganics.com | |||
| Chemical manufacturer | ||||
| P and M Invest Ltd. | Russian Federation | Inquire | ||
|---|---|---|---|---|
![]() |
+7 (495) 135-6494 | |||
![]() |
sales@fluorine.ru | |||
| Chemical manufacturer | ||||
| SynQuest Labs, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (386) 462-0788 | |||
![]() |
info@synquestlabs.com | |||
| Chemical manufacturer | ||||
| Zylexa Pharma Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (845) 299-6009/ | |||
![]() |
sales@zylexa-pharma.com,enquiries@zylexa-pharma.com | |||
| Chemical manufacturer | ||||
| Name | 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-Heptadecafluoro-1-phenyl-1,3-undecanedione |
|---|---|
| Synonyms | 1-Phenyl-2H,2H-perfluoroundecane-1,3-dione; 4,4,5,5,6 |
| Molecular Structure | ![]() |
| Molecular Formula | C17H7F17O2 |
| Molecular Weight | 566.21 |
| CAS Registry Number | 141522-69-2 |
| SMILES | O=C(c1ccccc1)CC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | 1S/C17H7F17O2/c18-10(19,9(36)6-8(35)7-4-2-1-3-5-7)11(20,21)12(22,23)13(24,25)14(26,27)15(28,29)16(30,31)17(32,33)34/h1-5H,6H2 |
| InChIKey | BMPCOBJGKAQEOM-UHFFFAOYSA-N |
| Density | 1.574g/cm3 (Cal.) |
|---|---|
| Melting point | 58-60°C (Expl.) |
| Boiling point | 321.572°C at 760 mmHg (Cal.) |
| 167-168°C (Expl.) | |
| Flash point | 123.311°C (Cal.) |
| Refractive index | 1.366 (Cal.) |
| Safety Description | R36/37/38 |
|---|---|
| S22,S24/25,S36/37/39,S45 | |
| Irritant | |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-Heptadecafluoro-1-phenyl-1,3-undecanedione |