Online Database of Chemicals from Around the World
| Name | 4-(4-Nitrophenylazo)Phenol |
|---|---|
| Synonyms | 4-[(4-Nitrophenyl)Hydrazono]Cyclohexa-2,5-Dien-1-One; 4-[(4-Nitrophenyl)Hydrazono]-1-Cyclohexa-2,5-Dienone; Nsc 45166 |
| Molecular Structure |  |
| Molecular Formula | C12H9N3O3 |
| Molecular Weight | 243.22 |
| CAS Registry Number | 1435-60-5 |
| SMILES | C2=C(NN=C1C=CC(=O)C=C1)C=CC(=C2)[N+]([O-])=O |
| InChI | 1S/C12H9N3O3/c16-12-7-3-10(4-8-12)14-13-9-1-5-11(6-2-9)15(17)18/h1-8,13H |
| InChIKey | ISHCVXKNSGUMPL-UHFFFAOYSA-N |
| Density | 1.345g/cm3 (Cal.) |
|---|---|
| Boiling point | 414.322°C at 760 mmHg (Cal.) |
| Flash point | 204.375°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 4-(4-Nitrophenylazo)Phenol |
