| Princeton BioMolecular Research, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (732) 355-9920 | |||
![]() |
info@princetonbio.com | |||
| Chemical manufacturer since 1998 | ||||
| ZereneX Molecular Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (1204) 527-700 | |||
![]() |
sales@zerenex-molecular.com | |||
| Chemical manufacturer | ||||
| Name | 4,4'-Bi[1-Naphthol] |
|---|---|
| Synonyms | 4-(4-Hydroxy-1-Naphthyl)Naphthalen-1-Ol; 4-(4-Hydroxy-1-Naphthyl)-1-Naphthalenol; 4-(4-Hydroxy-1-Naphthyl)-1-Naphthol |
| Molecular Structure | ![]() |
| Molecular Formula | C20H14O2 |
| Molecular Weight | 286.33 |
| CAS Registry Number | 1446-34-0 |
| SMILES | C1=CC(=C4C(=C1C2=C3C(=C(C=C2)O)C=CC=C3)C=CC=C4)O |
| InChI | 1S/C20H14O2/c21-19-11-9-15(13-5-1-3-7-17(13)19)16-10-12-20(22)18-8-4-2-6-14(16)18/h1-12,21-22H |
| InChIKey | VSFRAZDVMIDFOM-UHFFFAOYSA-N |
| Density | 1.303g/cm3 (Cal.) |
|---|---|
| Boiling point | 482.73°C at 760 mmHg (Cal.) |
| Flash point | 230.057°C (Cal.) |
| (1) | Taijiro Nakagawa, Kazuhiro Nakabayashi, Tomoya Higashihara and Mitsuru Ueda. A high performance polymer electrolyte membrane based on sulfonated poly(ether sulfone) with binaphthyl units, J. Mater. Chem., 2010, 20, 6662. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 4,4'-Bi[1-Naphthol] |