Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | Clorindanic Acid |
|---|---|
| Synonyms | 7-Chloro-4-Hydroxy-Indane-5-Carboxylic Acid; 7-Chloro-4-Hydroxy-5-Indanecarboxylic Acid; 1H-Indene-5-Carboxylic Acid, 2,3-Dihydro-7-Chloro-4-Hydroxy- |
| Molecular Structure |  |
| Molecular Formula | C10H9ClO3 |
| Molecular Weight | 212.63 |
| CAS Registry Number | 153-43-5 |
| SMILES | C1=C(C2=C(C(=C1C(O)=O)O)CCC2)Cl |
| InChI | 1S/C10H9ClO3/c11-8-4-7(10(13)14)9(12)6-3-1-2-5(6)8/h4,12H,1-3H2,(H,13,14) |
| InChIKey | UIEGCHMMGBNMIL-UHFFFAOYSA-N |
| Density | 1.503g/cm3 (Cal.) |
|---|---|
| Boiling point | 370.98°C at 760 mmHg (Cal.) |
| Flash point | 178.163°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Clorindanic Acid |