|
CAS#: 15360-52-8 Product: (3beta,5beta)-Androstan-3-Ol No suppilers available for the product. |
| Name | (3beta,5beta)-Androstan-3-Ol |
|---|---|
| Synonyms | 5-β-ANDROSTAN-3-α-OL; 5-β-ANDROSTAN-3-β-OL |
| Molecular Structure | ![]() |
| Molecular Formula | C19H32O |
| Molecular Weight | 276.46 |
| CAS Registry Number | 15360-52-8 |
| SMILES | O[C@@H]2C[C@H]3CC[C@H]1[C@@H]4CCC[C@@]4(C)CC[C@@H]1[C@@]3(C)CC2 |
| InChI | 1S/C19H32O/c1-18-9-3-4-16(18)15-6-5-13-12-14(20)7-11-19(13,2)17(15)8-10-18/h13-17,20H,3-12H2,1-2H3/t13-,14+,15+,16+,17+,18+,19+/m1/s1 |
| InChIKey | DJTOLSNIKJIDFF-KYQPOWKGSA-N |
| Density | 1.02g/cm3 (Cal.) |
|---|---|
| Boiling point | 375.913°C at 760 mmHg (Cal.) |
| Flash point | 158.43°C (Cal.) |
| Refractive index | (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (3beta,5beta)-Androstan-3-Ol |