|
CAS#: 15534-92-6 Product: Terbuficin No suppilers available for the product. |
| Name | Terbuficin |
|---|---|
| Synonyms | 2,2-Bis(3,5-Ditert-Butyl-4-Hydroxy-Phenyl)Acetic Acid; 2,2-Bis(3,5-Ditert-Butyl-4-Hydroxy-Phenyl)Ethanoic Acid; Terbuficin |
| Molecular Structure | ![]() |
| Molecular Formula | C30H44O4 |
| Molecular Weight | 468.68 |
| CAS Registry Number | 15534-92-6 |
| SMILES | C2=C(C(C1=CC(=C(C(=C1)C(C)(C)C)O)C(C)(C)C)C(O)=O)C=C(C(C)(C)C)C(=C2C(C)(C)C)O |
| InChI | 1S/C30H44O4/c1-27(2,3)19-13-17(14-20(24(19)31)28(4,5)6)23(26(33)34)18-15-21(29(7,8)9)25(32)22(16-18)30(10,11)12/h13-16,23,31-32H,1-12H3,(H,33,34) |
| InChIKey | YKROJXPZFTZLDK-UHFFFAOYSA-N |
| Density | 1.055g/cm3 (Cal.) |
|---|---|
| Boiling point | 494.853°C at 760 mmHg (Cal.) |
| Flash point | 267.176°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Terbuficin |