Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 4-Methyl-5-Nitro-1H-Benzimidazole |
|---|---|
| Synonyms | 1H-Benzimidazole,4-methyl-5-nitro-; 4-methyl-5-nitro-1H-benzo[d]imidazole |
| Molecular Structure |  |
| Molecular Formula | C8H7N3O2 |
| Molecular Weight | 177.16 |
| CAS Registry Number | 170918-28-2 |
| SMILES | [O-][N+](=O)c1ccc2ncnc2c1C |
| InChI | 1S/C8H7N3O2/c1-5-7(11(12)13)3-2-6-8(5)10-4-9-6/h2-4H,1H3,(H,9,10) |
| InChIKey | OUNJNOIRCNXHMH-UHFFFAOYSA-N |
| Density | 1.438g/cm3 (Cal.) |
|---|---|
| Boiling point | 458.772°C at 760 mmHg (Cal.) |
| Flash point | 231.257°C (Cal.) |
| Refractive index | 1.707 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 4-Methyl-5-Nitro-1H-Benzimidazole |