Online Database of Chemicals from Around the World
| Name | 1,3-Di(Adamantan-1-Yl)-2-Aziridinone |
|---|---|
| Synonyms | 1,3-Di(1-adamantyl)-2-aziridinone #; 1,3-Di(1-adamantyl)aziridin-2-one |
| Molecular Structure |  |
| Molecular Formula | C22H31NO |
| Molecular Weight | 325.49 |
| CAS Registry Number | 17385-51-2 |
| SMILES | O=C4N(C13CC2CC(C1)CC(C2)C3)C4C57CC6CC(C5)CC(C6)C7 |
| InChI | 1S/C22H31NO/c24-20-19(21-7-13-1-14(8-21)3-15(2-13)9-21)23(20)22-10-16-4-17(11-22)6-18(5-16)12-22/h13-19H,1-12H2 |
| InChIKey | GNOWFORRVQUOOE-UHFFFAOYSA-N |
| Density | 1.269g/cm3 (Cal.) |
|---|---|
| Boiling point | 431.546°C at 760 mmHg (Cal.) |
| Flash point | 190.27°C (Cal.) |
| Refractive index | 1.647 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3-Di(Adamantan-1-Yl)-2-Aziridinone |
