Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | L-gamma-Glutamyl-L-Methionine |
|---|---|
| Synonyms | γ-glutamylmethionine |
| Molecular Structure |  |
| Molecular Formula | C10H18N2O5S |
| Molecular Weight | 278.33 |
| CAS Registry Number | 17663-87-5 |
| SMILES | O=C(N[C@H](C(=O)O)CCSC)CC[C@@H](C(=O)O)N |
| InChI | 1S/C10H18N2O5S/c1-18-5-4-7(10(16)17)12-8(13)3-2-6(11)9(14)15/h6-7H,2-5,11H2,1H3,(H,12,13)(H,14,15)(H,16,17)/t6-,7-/m0/s1 |
| InChIKey | RQNSKRXMANOPQY-BQBZGAKWSA-N |
| Density | 1.343g/cm3 (Cal.) |
|---|---|
| Boiling point | 625.716°C at 760 mmHg (Cal.) |
| Flash point | 332.221°C (Cal.) |
| Refractive index | 1.556 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for L-gamma-Glutamyl-L-Methionine |