|
CAS#: 17874-34-9 Product: 8-Tert-Butyl-4,6-Dimethyl-2-Benzopyrone No suppilers available for the product. |
| Name | 8-Tert-Butyl-4,6-Dimethyl-2-Benzopyrone |
|---|---|
| Synonyms | 8-Tert-Butyl-4,6-Dimethyl-Chromen-2-One; 8-Tert-Butyl-4,6-Dimethyl-2-Chromenone; 8-Tert-Butyl-4,6-Dimethyl-Coumarin |
| Molecular Structure | ![]() |
| Molecular Formula | C15H18O2 |
| Molecular Weight | 230.31 |
| CAS Registry Number | 17874-34-9 |
| EINECS | 241-827-9 |
| SMILES | C1=C2C(=C(C=C1C)C(C)(C)C)OC(=O)C=C2C |
| InChI | 1S/C15H18O2/c1-9-6-11-10(2)8-13(16)17-14(11)12(7-9)15(3,4)5/h6-8H,1-5H3 |
| InChIKey | SIOLFBILQBRZOC-UHFFFAOYSA-N |
| Density | 1.056g/cm3 (Cal.) |
|---|---|
| Boiling point | 351.333°C at 760 mmHg (Cal.) |
| Flash point | 146.428°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 8-Tert-Butyl-4,6-Dimethyl-2-Benzopyrone |