Online Database of Chemicals from Around the World
|
CAS#: 18187-06-9 Product: Trimethylsilyl (Trimethylsilyl)Sulphamate No suppilers available for the product. |
| Name | Trimethylsilyl (Trimethylsilyl)Sulphamate |
|---|---|
| Synonyms | N-Trimethylsilylsulfamic Acid Trimethylsilyl Ester; Trimethylsilyl (Trimethylsilyl)Sulphamate |
| Molecular Structure |  |
| Molecular Formula | C6H19NO3SSi2 |
| Molecular Weight | 241.45 |
| CAS Registry Number | 18187-06-9 |
| EINECS | 242-073-3 |
| SMILES | C[Si](N[S](O[Si](C)(C)C)(=O)=O)(C)C |
| InChI | 1S/C6H19NO3SSi2/c1-12(2,3)7-11(8,9)10-13(4,5)6/h7H,1-6H3 |
| InChIKey | DJDBZHRIKZSDOX-UHFFFAOYSA-N |
| Density | 1.026g/cm3 (Cal.) |
|---|---|
| Boiling point | 233.903°C at 760 mmHg (Cal.) |
| Flash point | 95.261°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Trimethylsilyl (Trimethylsilyl)Sulphamate |