Online Database of Chemicals from Around the World
|
CAS#: 19150-32-4 Product: 1,4-Cyclohexanediyl Dibenzoate No suppilers available for the product. |
| Name | 1,4-Cyclohexanediyl Dibenzoate |
|---|---|
| Synonyms | 4-(Benzoyloxy)cyclohexyl benzoate # |
| Molecular Structure |  |
| Molecular Formula | C20H20O4 |
| Molecular Weight | 324.37 |
| CAS Registry Number | 19150-32-4 |
| SMILES | O=C(OC2CCC(OC(=O)c1ccccc1)CC2)c3ccccc3 |
| InChI | 1S/C20H20O4/c21-19(15-7-3-1-4-8-15)23-17-11-13-18(14-12-17)24-20(22)16-9-5-2-6-10-16/h1-10,17-18H,11-14H2 |
| InChIKey | ZLWCKIITGASJBS-UHFFFAOYSA-N |
| Density | 1.203g/cm3 (Cal.) |
|---|---|
| Boiling point | 446.781°C at 760 mmHg (Cal.) |
| Flash point | 221.822°C (Cal.) |
| Refractive index | 1.583 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,4-Cyclohexanediyl Dibenzoate |