Online Database of Chemicals from Around the World
| Name | 3,4-Dimethylphenyl Trifluoroacetate |
|---|---|
| Synonyms | 3,4-Dimethylphenol, TFA; 3,4-Dimethylphenyl trifluoroacetate # |
| Molecular Structure |  |
| Molecular Formula | C10H9F3O2 |
| Molecular Weight | 218.17 |
| CAS Registry Number | 1957-55-7 |
| SMILES | O=C(Oc1cc(c(cc1)C)C)C(F)(F)F |
| InChI | 1S/C10H9F3O2/c1-6-3-4-8(5-7(6)2)15-9(14)10(11,12)13/h3-5H,1-2H3 |
| InChIKey | VZDBXQOEWSTLFJ-UHFFFAOYSA-N |
| Density | 1.24g/cm3 (Cal.) |
|---|---|
| Boiling point | 190.361°C at 760 mmHg (Cal.) |
| Flash point | 43.709°C (Cal.) |
| Refractive index | 1.454 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,4-Dimethylphenyl Trifluoroacetate |
