Online Database of Chemicals from Around the World
|
CAS#: 196-28-1 Product: Dibenzo(c,mno)Chrysene No suppilers available for the product. |
| Name | Dibenzo(c,mno)Chrysene |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C24H14 |
| Molecular Weight | 302.37 |
| CAS Registry Number | 196-28-1 |
| EINECS | 205-897-4 |
| SMILES | C2=C5C(=C4C3=C1C(=CC=CC1=CC=C23)C=C4)C6=C(C=C5)C=CC=C6 |
| InChI | 1S/C24H14/c1-2-7-20-15(4-1)8-10-18-14-19-11-9-16-5-3-6-17-12-13-21(23(18)20)24(19)22(16)17/h1-14H |
| InChIKey | ANKRFBWKEPAECS-UHFFFAOYSA-N |
| Density | 1.313g/cm3 (Cal.) |
|---|---|
| Boiling point | 552.265°C at 760 mmHg (Cal.) |
| Flash point | 281.957°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dibenzo(c,mno)Chrysene |