Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Tyger Scientific Inc. | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (609) 434-0144 | |||
|
sales@tygersci.com | |||
| Chemical manufacturer since 1992 | ||||
| Name | 3-Dimethylamino Neopentyl Acrylate |
|---|---|
| Synonyms | (3-Dimethylamino-2,2-Dimethyl-Propyl) Prop-2-Enoate; Prop-2-Enoic Acid (3-Dimethylamino-2,2-Dimethylpropyl) Ester; Acrylic Acid (3-Dimethylamino-2,2-Dimethyl-Propyl) Ester |
| Molecular Structure |  |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 |
| CAS Registry Number | 20166-73-8 |
| EINECS | 243-553-5 |
| SMILES | C(C(CN(C)C)(C)C)OC(C=C)=O |
| InChI | 1S/C10H19NO2/c1-6-9(12)13-8-10(2,3)7-11(4)5/h6H,1,7-8H2,2-5H3 |
| InChIKey | SZWMBBRKRKJARM-UHFFFAOYSA-N |
| Density | 0.929g/cm3 (Cal.) |
|---|---|
| Boiling point | 234.984°C at 760 mmHg (Cal.) |
| Flash point | 78.506°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Dimethylamino Neopentyl Acrylate |