|
CAS#: 20168-88-1 Product: 6-Demethylgriseofulvin No suppilers available for the product. |
| Name | 6-Demethylgriseofulvin |
|---|---|
| Synonyms | 7-Chloro-6-Hydroxy-3',4-Dimethoxy-5'-Methyl-Spiro[Benzofuran-2,4'-Cyclohex-2-Ene]-1',3-Dione; 7-Chloro-6-Hydroxy-3',4-Dimethoxy-5'-Methylspiro[Benzofuran-2,4'-Cyclohex-2-Ene]-1',3-Dione; 7-Chloro-6-Hydroxy-3',4-Dimethoxy-5'-Methyl-Spiro[Benzofuran-2,4'-Cyclohex-2-Ene]-1',3-Quinone |
| Molecular Structure | ![]() |
| Molecular Formula | C16H15ClO6 |
| Molecular Weight | 338.74 |
| CAS Registry Number | 20168-88-1 |
| SMILES | C3=C(C1=C(OC2(C1=O)C(=CC(CC2C)=O)OC)C(=C3O)Cl)OC |
| InChI | 1S/C16H15ClO6/c1-7-4-8(18)5-11(22-3)16(7)15(20)12-10(21-2)6-9(19)13(17)14(12)23-16/h5-7,19H,4H2,1-3H3 |
| InChIKey | SYNGDIBHUPXIQA-UHFFFAOYSA-N |
| Density | 1.471g/cm3 (Cal.) |
|---|---|
| Boiling point | 600.765°C at 760 mmHg (Cal.) |
| Flash point | 317.132°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Demethylgriseofulvin |