Online Database of Chemicals from Around the World
| Name | Acenaphthyleno[2,1-B]Quinoline |
|---|---|
| Synonyms | Acenaphtho[2,1-B]Quinoline; Acenaphtho(1,2-B)Quinoline; Ccris 6579 |
| Molecular Structure | ![CAS#: 207-09-0， Acenaphthyleno[2,1-B]Quinoline](/moreStructures/207-09-0.gif) |
| Molecular Formula | C19H11N |
| Molecular Weight | 253.30 |
| CAS Registry Number | 207-09-0 |
| SMILES | C2=C1C=CC=CC1=NC4=C2C3=C5C(=CC=C3)C=CC=C45 |
| InChI | 1S/C19H11N/c1-2-10-17-13(5-1)11-16-14-8-3-6-12-7-4-9-15(18(12)14)19(16)20-17/h1-11H |
| InChIKey | WUFVHJGSUUJBSY-UHFFFAOYSA-N |
| Density | 1.338g/cm3 (Cal.) |
|---|---|
| Boiling point | 476.914°C at 760 mmHg (Cal.) |
| Flash point | 215.237°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Acenaphthyleno[2,1-B]Quinoline |
