| AccuStandard Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (203) 786-5290 | |||
![]() |
orders@accustandard.com | |||
| Chemical manufacturer since 1986 | ||||
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Fluorochem Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (1457) 860-111 | |||
![]() |
enquiries@fluorochem.co.uk | |||
| Chemical manufacturer | ||||
| Ryan Scientific, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (843)-884-4911 | |||
![]() |
sales@ryansci.com | |||
| Chemical manufacturer | ||||
| Sigma-Aldrich, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Classification | Analytical chemistry >> Standard >> Food and beverage standards |
|---|---|
| Name | 4,4'-(1,1-Ethanediyl)Diphenol |
| Synonyms | 1,1-bis-(4-hydroxyphenyl)-ethane; 1,1-Bis(4-hydroxyphenyl)ethane; 2081/8/5 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H14O2 |
| Molecular Weight | 214.26 |
| CAS Registry Number | 2081-08-5 |
| SMILES | Oc1ccc(cc1)C(c2ccc(O)cc2)C |
| InChI | 1S/C14H14O2/c1-10(11-2-6-13(15)7-3-11)12-4-8-14(16)9-5-12/h2-10,15-16H,1H3 |
| InChIKey | HCNHNBLSNVSJTJ-UHFFFAOYSA-N |
| Density | 1.171g/cm3 (Cal.) |
|---|---|
| Melting point | 125°C (Expl.) |
| Boiling point | 375.71°C at 760 mmHg (Cal.) |
| Flash point | 181.381°C (Cal.) |
| Refractive index | 1.616 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 4,4'-(1,1-Ethanediyl)Diphenol |