| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Indofine Chemical Company, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (908) 359-6778 | |||
![]() |
fo@indofinechemical.com | |||
| Chemical manufacturer since 1996 | ||||
| Manchester Organics Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (1928) 710-200 | |||
![]() |
info@manchesterorganics.com | |||
| Chemical manufacturer | ||||
| Matrix Scientific Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (803) 788-9494 | |||
![]() |
sales@matrixscientific.com | |||
| Chemical manufacturer | ||||
| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
![]() |
+380 (44) 522-2458 | |||
![]() |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| P and M Invest Ltd. | Russian Federation | Inquire | ||
|---|---|---|---|---|
![]() |
+7 (495) 135-6494 | |||
![]() |
sales@fluorine.ru | |||
| Chemical manufacturer | ||||
| SynQuest Labs, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (386) 462-0788 | |||
![]() |
info@synquestlabs.com | |||
| Chemical manufacturer | ||||
| Name | (3E)-4-(Diethylamino)-1,1,1-Trifluoro-3-Buten-2-One |
|---|---|
| Synonyms | 4-(diethylamino)-1,1,1-trifluorobut-3-en-2-one; 4-Diethylamino-1,1,1-trifluorobut-3-en-2-one; 4-Diethylamino-1,1,1-trifluorobut-3-ene-2-one |
| Molecular Structure | ![]() |
| Molecular Formula | C8H12F3NO |
| Molecular Weight | 195.18 |
| CAS Registry Number | 21045-62-5 |
| SMILES | FC(F)(F)C(=O)\C=C\N(CC)CC |
| InChI | 1S/C8H12F3NO/c1-3-12(4-2)6-5-7(13)8(9,10)11/h5-6H,3-4H2,1-2H3/b6-5+ |
| InChIKey | QKPHMBNBSBNCJN-AATRIKPKSA-N |
| Density | 1.116g/cm3 (Cal.) |
|---|---|
| Melting point | 12-13°C (Expl.) |
| Boiling point | 301.4524-302.955°C (Expl.) |
| 153.702°C at 760 mmHg (Cal.) | |
| Flash point | 46.757°C (Cal.) |
| Refractive index | 1.41 (Cal.) |
| 1.4879 (Expl.) | |
| Safety Description | Irritant |
|---|---|
| IRRITANT | |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for (3E)-4-(Diethylamino)-1,1,1-Trifluoro-3-Buten-2-One |