| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Magical Scientific, LLC. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (913) 594-2243 | |||
![]() |
sales@magicalsci.com | |||
| Chemical manufacturer | ||||
| PepTech Corporation | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (781) 273-5400 | |||
![]() |
service@peptechcorp.com | |||
| Chemical manufacturer | ||||
| Tocris Bioscience Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (636) 207-7651 | |||
![]() |
marketing@tocrisusa.com | |||
| Chemical manufacturer since 1982 | ||||
| Name | 1-Amino-5-Phosphono-1-Indanecarboxylic Acid |
|---|---|
| Synonyms | (RS)-1-Amino-5-phosphonoindan-1-carboxylic acid; (RS)-APICA; 1-amino-5-phosphono-2,3-dihydro-1H-indene-1-carboxylic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C10H12NO5P |
| Molecular Weight | 257.18 |
| CAS Registry Number | 220029-96-9 |
| SMILES | C1CC(C2=C1C=C(C=C2)P(=O)(O)O)(C(=O)O)N |
| InChI | 1S/C10H12NO5P/c11-10(9(12)13)4-3-6-5-7(17(14,15)16)1-2-8(6)10/h1-2,5H,3-4,11H2,(H,12,13)(H2,14,15,16) |
| InChIKey | ZNQZXIHSJUDIKL-UHFFFAOYSA-N |
| Density | 1.6±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 559.9±60.0°C at 760 mmHg (Cal.) |
| Flash point | 292.4±32.9°C (Cal.) |
| Refractive index | 1.671 (Cal.) |
| solubility | Soluble to 100 mM in 1.1eq. NaOH |
| Market Analysis Reports |
| List of Reports Available for 1-Amino-5-Phosphono-1-Indanecarboxylic Acid |